N-[2-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide
N-[2-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y031-1404 |
| Compound Name: | N-[2-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide |
| Molecular Weight: | 336.41 |
| Molecular Formula: | C19 H16 N2 O2 S |
| Smiles: | C(c1ccccc1)NC(c1ccccc1NC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6565 |
| logD: | 3.6554 |
| logSw: | -4.0709 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.063 |
| InChI Key: | KVRLJVCIQXIWMN-UHFFFAOYSA-N |