N-butyl-2-phenoxy-N-phenylpropanamide
Chemical Structure Depiction of
N-butyl-2-phenoxy-N-phenylpropanamide
N-butyl-2-phenoxy-N-phenylpropanamide
Compound characteristics
| Compound ID: | Y031-1498 |
| Compound Name: | N-butyl-2-phenoxy-N-phenylpropanamide |
| Molecular Weight: | 297.4 |
| Molecular Formula: | C19 H23 N O2 |
| Smiles: | CCCCN(C(C(C)Oc1ccccc1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5361 |
| logD: | 4.5361 |
| logSw: | -4.0572 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 22.6285 |
| InChI Key: | FMCGNTMMELMMOJ-INIZCTEOSA-N |