4-(3,5-dimethylpiperidine-1-carbonyl)-1-(4-ethoxyphenyl)pyrrolidin-2-one
Chemical Structure Depiction of
4-(3,5-dimethylpiperidine-1-carbonyl)-1-(4-ethoxyphenyl)pyrrolidin-2-one
4-(3,5-dimethylpiperidine-1-carbonyl)-1-(4-ethoxyphenyl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | Y031-3597 |
| Compound Name: | 4-(3,5-dimethylpiperidine-1-carbonyl)-1-(4-ethoxyphenyl)pyrrolidin-2-one |
| Molecular Weight: | 344.45 |
| Molecular Formula: | C20 H28 N2 O3 |
| Smiles: | CCOc1ccc(cc1)N1CC(CC1=O)C(N1CC(C)CC(C)C1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.027 |
| logD: | 3.027 |
| logSw: | -3.115 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.627 |
| InChI Key: | PPIZNSGJDXBZAA-UHFFFAOYSA-N |