1-butyl-N-{4-[(2,4-dimethoxyphenyl)carbamoyl]phenyl}-5-oxopyrrolidine-3-carboxamide
Chemical Structure Depiction of
1-butyl-N-{4-[(2,4-dimethoxyphenyl)carbamoyl]phenyl}-5-oxopyrrolidine-3-carboxamide
1-butyl-N-{4-[(2,4-dimethoxyphenyl)carbamoyl]phenyl}-5-oxopyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | Y031-5266 |
| Compound Name: | 1-butyl-N-{4-[(2,4-dimethoxyphenyl)carbamoyl]phenyl}-5-oxopyrrolidine-3-carboxamide |
| Molecular Weight: | 439.51 |
| Molecular Formula: | C24 H29 N3 O5 |
| Smiles: | CCCCN1CC(CC1=O)C(Nc1ccc(cc1)C(Nc1ccc(cc1OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5759 |
| logD: | 2.5697 |
| logSw: | -3.1159 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.343 |
| InChI Key: | QUCDTOGCFKPXCA-QGZVFWFLSA-N |