[1-(3-fluorobenzoyl)piperidin-4-yl][4-(4-fluorophenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
[1-(3-fluorobenzoyl)piperidin-4-yl][4-(4-fluorophenyl)piperazin-1-yl]methanone
[1-(3-fluorobenzoyl)piperidin-4-yl][4-(4-fluorophenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | Y031-5640 |
| Compound Name: | [1-(3-fluorobenzoyl)piperidin-4-yl][4-(4-fluorophenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 413.47 |
| Molecular Formula: | C23 H25 F2 N3 O2 |
| Smiles: | C1CN(CCC1C(N1CCN(CC1)c1ccc(cc1)F)=O)C(c1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8439 |
| logD: | 2.8439 |
| logSw: | -2.9964 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.795 |
| InChI Key: | WQTWAEAYXGHNIE-UHFFFAOYSA-N |