N-[2-(butylcarbamoyl)phenyl]-1-(3-chlorobenzoyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-[2-(butylcarbamoyl)phenyl]-1-(3-chlorobenzoyl)piperidine-4-carboxamide
N-[2-(butylcarbamoyl)phenyl]-1-(3-chlorobenzoyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | Y031-6193 |
| Compound Name: | N-[2-(butylcarbamoyl)phenyl]-1-(3-chlorobenzoyl)piperidine-4-carboxamide |
| Molecular Weight: | 441.96 |
| Molecular Formula: | C24 H28 Cl N3 O3 |
| Smiles: | CCCCNC(c1ccccc1NC(C1CCN(CC1)C(c1cccc(c1)[Cl])=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.632 |
| logD: | 3.6298 |
| logSw: | -3.9854 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.806 |
| InChI Key: | DPIWWXQWZNSCPL-UHFFFAOYSA-N |