N-tert-butyl-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide
Chemical Structure Depiction of
N-tert-butyl-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide
N-tert-butyl-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | Y031-7262 |
| Compound Name: | N-tert-butyl-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide |
| Molecular Weight: | 268.4 |
| Molecular Formula: | C15 H28 N2 O2 |
| Smiles: | CC(C)(C)C(N1CCCC(C1)C(NC(C)(C)C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2265 |
| logD: | 2.2265 |
| logSw: | -2.6329 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.6 |
| InChI Key: | HRFVFPLLDKUNTH-NSHDSACASA-N |