N~1~,N~1~-dimethyl-N~3~-phenylpiperidine-1,3-dicarboxamide
Chemical Structure Depiction of
N~1~,N~1~-dimethyl-N~3~-phenylpiperidine-1,3-dicarboxamide
N~1~,N~1~-dimethyl-N~3~-phenylpiperidine-1,3-dicarboxamide
Compound characteristics
| Compound ID: | Y031-7356 |
| Compound Name: | N~1~,N~1~-dimethyl-N~3~-phenylpiperidine-1,3-dicarboxamide |
| Molecular Weight: | 275.35 |
| Molecular Formula: | C15 H21 N3 O2 |
| Smiles: | CN(C)C(N1CCCC(C1)C(Nc1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3523 |
| logD: | 1.3523 |
| logSw: | -1.8158 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.069 |
| InChI Key: | NFFRWZWCYFJQFE-LBPRGKRZSA-N |