N-(2-hydroxyethyl)-N-methyl-4-nitrobenzene-1-sulfonamide
Chemical Structure Depiction of
N-(2-hydroxyethyl)-N-methyl-4-nitrobenzene-1-sulfonamide
N-(2-hydroxyethyl)-N-methyl-4-nitrobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y031-7675 |
| Compound Name: | N-(2-hydroxyethyl)-N-methyl-4-nitrobenzene-1-sulfonamide |
| Molecular Weight: | 260.27 |
| Molecular Formula: | C9 H12 N2 O5 S |
| Smiles: | CN(CCO)S(c1ccc(cc1)[N+]([O-])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8609 |
| logD: | 0.8609 |
| logSw: | -2.1286 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 83.09 |
| InChI Key: | BPHLMIDHXPVULA-UHFFFAOYSA-N |