N-[(2-methoxyphenyl)methyl]-4-methyl-3-nitrobenzamide
Chemical Structure Depiction of
N-[(2-methoxyphenyl)methyl]-4-methyl-3-nitrobenzamide
N-[(2-methoxyphenyl)methyl]-4-methyl-3-nitrobenzamide
Compound characteristics
| Compound ID: | Y031-8169 |
| Compound Name: | N-[(2-methoxyphenyl)methyl]-4-methyl-3-nitrobenzamide |
| Molecular Weight: | 300.31 |
| Molecular Formula: | C16 H16 N2 O4 |
| Smiles: | Cc1ccc(cc1[N+]([O-])=O)C(NCc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2562 |
| logD: | 3.2559 |
| logSw: | -3.5205 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.363 |
| InChI Key: | GNUACNGBBDDYBJ-UHFFFAOYSA-N |