N-(2-ethoxyphenyl)-4-nitrobenzene-1-sulfonamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-4-nitrobenzene-1-sulfonamide
N-(2-ethoxyphenyl)-4-nitrobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y031-8437 |
| Compound Name: | N-(2-ethoxyphenyl)-4-nitrobenzene-1-sulfonamide |
| Molecular Weight: | 322.34 |
| Molecular Formula: | C14 H14 N2 O5 S |
| Smiles: | CCOc1ccccc1NS(c1ccc(cc1)[N+]([O-])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0789 |
| logD: | 1.9184 |
| logSw: | -3.6417 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.782 |
| InChI Key: | HCZZMHPBWAKKNO-UHFFFAOYSA-N |