N-(diphenylmethyl)-4-methyl-3-nitrobenzamide
Chemical Structure Depiction of
N-(diphenylmethyl)-4-methyl-3-nitrobenzamide
N-(diphenylmethyl)-4-methyl-3-nitrobenzamide
Compound characteristics
| Compound ID: | Y031-8607 |
| Compound Name: | N-(diphenylmethyl)-4-methyl-3-nitrobenzamide |
| Molecular Weight: | 346.38 |
| Molecular Formula: | C21 H18 N2 O3 |
| Smiles: | Cc1ccc(cc1[N+]([O-])=O)C(NC(c1ccccc1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5453 |
| logD: | 4.4966 |
| logSw: | -4.4166 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.813 |
| InChI Key: | LSUURGDLVVFGBE-UHFFFAOYSA-N |