(2-chlorophenyl)(2,3-dihydro-1H-indol-1-yl)methanone
Chemical Structure Depiction of
(2-chlorophenyl)(2,3-dihydro-1H-indol-1-yl)methanone
(2-chlorophenyl)(2,3-dihydro-1H-indol-1-yl)methanone
Compound characteristics
| Compound ID: | Y031-8674 |
| Compound Name: | (2-chlorophenyl)(2,3-dihydro-1H-indol-1-yl)methanone |
| Molecular Weight: | 257.72 |
| Molecular Formula: | C15 H12 Cl N O |
| Smiles: | C1CN(C(c2ccccc2[Cl])=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.5071 |
| logD: | 3.5071 |
| logSw: | -3.8639 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 15.9172 |
| InChI Key: | ANKQPDRJDDTGOT-UHFFFAOYSA-N |