diethyl 2,2'-[(1,2-dioxoethane-1,2-diyl)bis(azanediyl)]dibenzoate
Chemical Structure Depiction of
diethyl 2,2'-[(1,2-dioxoethane-1,2-diyl)bis(azanediyl)]dibenzoate
diethyl 2,2'-[(1,2-dioxoethane-1,2-diyl)bis(azanediyl)]dibenzoate
Compound characteristics
| Compound ID: | Y032-0468 |
| Compound Name: | diethyl 2,2'-[(1,2-dioxoethane-1,2-diyl)bis(azanediyl)]dibenzoate |
| Molecular Weight: | 384.39 |
| Molecular Formula: | C20 H20 N2 O6 |
| Smiles: | CCOC(c1ccccc1NC(C(Nc1ccccc1C(=O)OCC)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3667 |
| logD: | 1.4719 |
| logSw: | -3.7089 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.804 |
| InChI Key: | NSSFSSGVOUOLBK-UHFFFAOYSA-N |