3-(2H-1,3-benzodioxol-5-yl)-N,N-diethylprop-2-enamide
Chemical Structure Depiction of
3-(2H-1,3-benzodioxol-5-yl)-N,N-diethylprop-2-enamide
3-(2H-1,3-benzodioxol-5-yl)-N,N-diethylprop-2-enamide
Compound characteristics
| Compound ID: | Y032-0990 |
| Compound Name: | 3-(2H-1,3-benzodioxol-5-yl)-N,N-diethylprop-2-enamide |
| Molecular Weight: | 247.29 |
| Molecular Formula: | C14 H17 N O3 |
| Smiles: | CCN(CC)C(/C=C/c1ccc2c(c1)OCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.643 |
| logD: | 2.6427 |
| logSw: | -2.9553 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.758 |
| InChI Key: | DEQSVZNNNQWMJW-UHFFFAOYSA-N |