N-(2-fluoro-5-nitrophenyl)-2-methoxy-4-(methylsulfanyl)benzamide
Chemical Structure Depiction of
N-(2-fluoro-5-nitrophenyl)-2-methoxy-4-(methylsulfanyl)benzamide
N-(2-fluoro-5-nitrophenyl)-2-methoxy-4-(methylsulfanyl)benzamide
Compound characteristics
| Compound ID: | Y032-1295 |
| Compound Name: | N-(2-fluoro-5-nitrophenyl)-2-methoxy-4-(methylsulfanyl)benzamide |
| Molecular Weight: | 336.34 |
| Molecular Formula: | C15 H13 F N2 O4 S |
| Smiles: | COc1cc(ccc1C(Nc1cc(ccc1F)[N+]([O-])=O)=O)SC |
| Stereo: | ACHIRAL |
| logP: | 3.8712 |
| logD: | 2.0039 |
| logSw: | -4.1407 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.644 |
| InChI Key: | OOXNSEVAVBXSHD-UHFFFAOYSA-N |