N-[3-(diethylamino)propyl]-2-methoxy-4-(methylsulfanyl)benzamide
Chemical Structure Depiction of
N-[3-(diethylamino)propyl]-2-methoxy-4-(methylsulfanyl)benzamide
N-[3-(diethylamino)propyl]-2-methoxy-4-(methylsulfanyl)benzamide
Compound characteristics
| Compound ID: | Y032-1298 |
| Compound Name: | N-[3-(diethylamino)propyl]-2-methoxy-4-(methylsulfanyl)benzamide |
| Molecular Weight: | 310.46 |
| Molecular Formula: | C16 H26 N2 O2 S |
| Smiles: | CCN(CC)CCCNC(c1ccc(cc1OC)SC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9352 |
| logD: | 0.2142 |
| logSw: | -3.402 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.806 |
| InChI Key: | NQWYAVMJZFQLPZ-UHFFFAOYSA-N |