2-(4-fluorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}acetamide
Chemical Structure Depiction of
2-(4-fluorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}acetamide
2-(4-fluorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}acetamide
Compound characteristics
| Compound ID: | Y032-2112 |
| Compound Name: | 2-(4-fluorophenyl)-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}acetamide |
| Molecular Weight: | 386.4 |
| Molecular Formula: | C18 H15 F N4 O3 S |
| Smiles: | C(C(Nc1ccc(cc1)S(Nc1ncccn1)(=O)=O)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 1.6432 |
| logD: | 0.888 |
| logSw: | -2.8562 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 84.335 |
| InChI Key: | VRQZMTHTKACLJR-UHFFFAOYSA-N |