5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-phenyl-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-phenyl-1,2-oxazole-4-carboxamide
5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-phenyl-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | Y032-2200 |
| Compound Name: | 5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-phenyl-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 300.34 |
| Molecular Formula: | C14 H12 N4 O2 S |
| Smiles: | Cc1c(C(Nc2nnc(C)s2)=O)c(c2ccccc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.2325 |
| logD: | 1.9871 |
| logSw: | -2.8547 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.641 |
| InChI Key: | IQWYHEXZXAJCGQ-UHFFFAOYSA-N |