2-methyl-3-phenyl-N-(1,3-thiazol-2-yl)prop-2-enamide
Chemical Structure Depiction of
2-methyl-3-phenyl-N-(1,3-thiazol-2-yl)prop-2-enamide
2-methyl-3-phenyl-N-(1,3-thiazol-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | Y032-2940 |
| Compound Name: | 2-methyl-3-phenyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
| Molecular Weight: | 244.31 |
| Molecular Formula: | C13 H12 N2 O S |
| Smiles: | C/C(=C\c1ccccc1)C(Nc1nccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2405 |
| logD: | 3.2393 |
| logSw: | -3.5464 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.808 |
| InChI Key: | NMSJVSMDGGLYBX-UHFFFAOYSA-N |