3-(3-methoxyphenyl)-5,9-dimethyl-6-pentyl-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
3-(3-methoxyphenyl)-5,9-dimethyl-6-pentyl-7H-furo[3,2-g][1]benzopyran-7-one
3-(3-methoxyphenyl)-5,9-dimethyl-6-pentyl-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | Y040-0170 |
| Compound Name: | 3-(3-methoxyphenyl)-5,9-dimethyl-6-pentyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 390.48 |
| Molecular Formula: | C25 H26 O4 |
| Smiles: | CCCCCC1=C(C)c2cc3c(coc3c(C)c2OC1=O)c1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 7.1543 |
| logD: | 7.1543 |
| logSw: | -5.7745 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.909 |
| InChI Key: | ZUIOPAIHNPCLKR-UHFFFAOYSA-N |