N-(5-tert-butyl-2-methoxyphenyl)-2-[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide
Chemical Structure Depiction of
N-(5-tert-butyl-2-methoxyphenyl)-2-[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide
N-(5-tert-butyl-2-methoxyphenyl)-2-[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide
Compound characteristics
| Compound ID: | Y040-0756 |
| Compound Name: | N-(5-tert-butyl-2-methoxyphenyl)-2-[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide |
| Molecular Weight: | 449.55 |
| Molecular Formula: | C27 H31 N O5 |
| Smiles: | Cc1c(ccc2C3CCCCC=3C(=O)Oc12)OCC(Nc1cc(ccc1OC)C(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0218 |
| logD: | 6.0217 |
| logSw: | -5.46 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.161 |
| InChI Key: | HLQOLVSNCZXLBD-UHFFFAOYSA-N |