4-ethyl-7-methyl-5-[2-(4-methylphenyl)-2-oxoethoxy]-2H-1-benzopyran-2-one
Chemical Structure Depiction of
4-ethyl-7-methyl-5-[2-(4-methylphenyl)-2-oxoethoxy]-2H-1-benzopyran-2-one
4-ethyl-7-methyl-5-[2-(4-methylphenyl)-2-oxoethoxy]-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | Y040-1156 |
| Compound Name: | 4-ethyl-7-methyl-5-[2-(4-methylphenyl)-2-oxoethoxy]-2H-1-benzopyran-2-one |
| Molecular Weight: | 336.39 |
| Molecular Formula: | C21 H20 O4 |
| Smiles: | CCC1=CC(=O)Oc2cc(C)cc(c12)OCC(c1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4333 |
| logD: | 4.4333 |
| logSw: | -4.5682 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.207 |
| InChI Key: | UGSRUDWOCJSXFD-UHFFFAOYSA-N |