7-[2-(4-fluorophenyl)-2-oxoethoxy]-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one
Chemical Structure Depiction of
7-[2-(4-fluorophenyl)-2-oxoethoxy]-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one
7-[2-(4-fluorophenyl)-2-oxoethoxy]-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one
Compound characteristics
| Compound ID: | Y040-1217 |
| Compound Name: | 7-[2-(4-fluorophenyl)-2-oxoethoxy]-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one |
| Molecular Weight: | 338.33 |
| Molecular Formula: | C20 H15 F O4 |
| Smiles: | C1CC2=C(C1)c1ccc(cc1OC2=O)OCC(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2986 |
| logD: | 3.2986 |
| logSw: | -3.7497 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.921 |
| InChI Key: | ANHLEUNXHQNBCX-UHFFFAOYSA-N |