3-[(3,4,5-trimethoxyphenyl)methyl]-3,4,8,9-tetrahydro-2H-cyclopenta[4,5]pyrano[2,3-f][1,3]benzoxazin-6(7H)-one
Chemical Structure Depiction of
3-[(3,4,5-trimethoxyphenyl)methyl]-3,4,8,9-tetrahydro-2H-cyclopenta[4,5]pyrano[2,3-f][1,3]benzoxazin-6(7H)-one
3-[(3,4,5-trimethoxyphenyl)methyl]-3,4,8,9-tetrahydro-2H-cyclopenta[4,5]pyrano[2,3-f][1,3]benzoxazin-6(7H)-one
Compound characteristics
| Compound ID: | Y040-1657 |
| Compound Name: | 3-[(3,4,5-trimethoxyphenyl)methyl]-3,4,8,9-tetrahydro-2H-cyclopenta[4,5]pyrano[2,3-f][1,3]benzoxazin-6(7H)-one |
| Molecular Weight: | 423.46 |
| Molecular Formula: | C24 H25 N O6 |
| Smiles: | COc1cc(CN2Cc3c(ccc4C5CCCC=5C(=O)Oc34)OC2)cc(c1OC)OC |
| Stereo: | ACHIRAL |
| logP: | 3.4639 |
| logD: | 1.1391 |
| logSw: | -3.8242 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.693 |
| InChI Key: | GMBIZUGHODMMIU-UHFFFAOYSA-N |