3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | Y040-2195 |
| Compound Name: | 3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 382.39 |
| Molecular Formula: | C22 H19 F O5 |
| Smiles: | COc1ccc(cc1F)C(COc1ccc2C3CCCCC=3C(=O)Oc2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4125 |
| logD: | 4.4125 |
| logSw: | -4.5084 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.186 |
| InChI Key: | USJWJDRCUBGOPN-UHFFFAOYSA-N |