3-[1-oxo-1-(piperidin-1-yl)butan-2-yl]-1,2,3-benzotriazin-4(3H)-one
Chemical Structure Depiction of
3-[1-oxo-1-(piperidin-1-yl)butan-2-yl]-1,2,3-benzotriazin-4(3H)-one
3-[1-oxo-1-(piperidin-1-yl)butan-2-yl]-1,2,3-benzotriazin-4(3H)-one
Compound characteristics
| Compound ID: | Y040-2946 |
| Compound Name: | 3-[1-oxo-1-(piperidin-1-yl)butan-2-yl]-1,2,3-benzotriazin-4(3H)-one |
| Molecular Weight: | 300.36 |
| Molecular Formula: | C16 H20 N4 O2 |
| Smiles: | CCC(C(N1CCCCC1)=O)N1C(c2ccccc2N=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0093 |
| logD: | 3.0093 |
| logSw: | -3.4976 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.97 |
| InChI Key: | PCCVFVBKGSGYLR-AWEZNQCLSA-N |