N,N-diethyl-2-[(2-ethyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide
Chemical Structure Depiction of
N,N-diethyl-2-[(2-ethyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide
N,N-diethyl-2-[(2-ethyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide
Compound characteristics
| Compound ID: | Y040-4110 |
| Compound Name: | N,N-diethyl-2-[(2-ethyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]acetamide |
| Molecular Weight: | 357.45 |
| Molecular Formula: | C21 H27 N O4 |
| Smiles: | CCc1cc2C3CCCCC=3C(=O)Oc2cc1OCC(N(CC)CC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9111 |
| logD: | 3.9111 |
| logSw: | -3.9404 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.071 |
| InChI Key: | MJHQPTPYWNECMY-UHFFFAOYSA-N |