7'-[(2-chloro-6-fluorophenyl)methoxy]-8-methoxy-2H,2'H-[3,4'-bi-1-benzopyran]-2,2'-dione
Chemical Structure Depiction of
7'-[(2-chloro-6-fluorophenyl)methoxy]-8-methoxy-2H,2'H-[3,4'-bi-1-benzopyran]-2,2'-dione
7'-[(2-chloro-6-fluorophenyl)methoxy]-8-methoxy-2H,2'H-[3,4'-bi-1-benzopyran]-2,2'-dione
Compound characteristics
| Compound ID: | Y040-4387 |
| Compound Name: | 7'-[(2-chloro-6-fluorophenyl)methoxy]-8-methoxy-2H,2'H-[3,4'-bi-1-benzopyran]-2,2'-dione |
| Molecular Weight: | 478.86 |
| Molecular Formula: | C26 H16 Cl F O6 |
| Smiles: | COc1cccc2C=C(C3=CC(=O)Oc4cc(ccc34)OCc3c(cccc3[Cl])F)C(=O)Oc12 |
| Stereo: | ACHIRAL |
| logP: | 4.8516 |
| logD: | 4.8516 |
| logSw: | -4.9418 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.838 |
| InChI Key: | CNWYPPQZRLVLJC-UHFFFAOYSA-N |