2-(4-fluorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide
Chemical Structure Depiction of
2-(4-fluorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide
2-(4-fluorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y040-5692 |
| Compound Name: | 2-(4-fluorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide |
| Molecular Weight: | 449.5 |
| Molecular Formula: | C24 H20 F N3 O3 S |
| Smiles: | C(CNC(c1cc(c2ccc(cc2)F)nc2ccccc12)=O)c1ccc(cc1)S(N)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8423 |
| logD: | 3.8416 |
| logSw: | -4.2269 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 83.156 |
| InChI Key: | XVBIWPSHPTXGMF-UHFFFAOYSA-N |