(4RS)-2-[3-(difluoromethoxy)phenyl]-1,3-thiazolidine-4-carboxylic acid
Chemical Structure Depiction of
(4RS)-2-[3-(difluoromethoxy)phenyl]-1,3-thiazolidine-4-carboxylic acid
(4RS)-2-[3-(difluoromethoxy)phenyl]-1,3-thiazolidine-4-carboxylic acid
Compound characteristics
| Compound ID: | Y040-6839 |
| Compound Name: | (4RS)-2-[3-(difluoromethoxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
| Molecular Weight: | 275.27 |
| Molecular Formula: | C11 H11 F2 N O3 S |
| Smiles: | C1[C@@H](C(O)=O)NC(c2cccc(c2)OC(F)F)S1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 0.7804 |
| logD: | -2.6821 |
| logSw: | -1.9563 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.218 |
| InChI Key: | MKELJKCVNKLGPM-VEDVMXKPSA-N |