3-[(2-methoxy-5-nitrophenyl)methoxy]-4-methyl-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
3-[(2-methoxy-5-nitrophenyl)methoxy]-4-methyl-6H-dibenzo[b,d]pyran-6-one
3-[(2-methoxy-5-nitrophenyl)methoxy]-4-methyl-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | Y040-6958 |
| Compound Name: | 3-[(2-methoxy-5-nitrophenyl)methoxy]-4-methyl-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 391.38 |
| Molecular Formula: | C22 H17 N O6 |
| Smiles: | Cc1c(ccc2c3ccccc3C(=O)Oc12)OCc1cc(ccc1OC)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4047 |
| logD: | 4.4047 |
| logSw: | -5.1695 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 68.899 |
| InChI Key: | GOSFEFCAJZSEEX-UHFFFAOYSA-N |