3-hydroxy-4-[(piperidin-1-yl)methyl]-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
3-hydroxy-4-[(piperidin-1-yl)methyl]-6H-dibenzo[b,d]pyran-6-one
3-hydroxy-4-[(piperidin-1-yl)methyl]-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | Y040-7579 |
| Compound Name: | 3-hydroxy-4-[(piperidin-1-yl)methyl]-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 309.36 |
| Molecular Formula: | C19 H19 N O3 |
| Smiles: | C1CCN(CC1)Cc1c(ccc2c3ccccc3C(=O)Oc12)O |
| Stereo: | ACHIRAL |
| logP: | 3.2241 |
| logD: | 2.9292 |
| logSw: | -3.707 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.854 |
| InChI Key: | HTQCTSJTPATYAY-UHFFFAOYSA-N |