2-hexyl-3-[(2-methoxy-5-nitrophenyl)methoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
2-hexyl-3-[(2-methoxy-5-nitrophenyl)methoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
2-hexyl-3-[(2-methoxy-5-nitrophenyl)methoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | Y040-7672 |
| Compound Name: | 2-hexyl-3-[(2-methoxy-5-nitrophenyl)methoxy]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 465.55 |
| Molecular Formula: | C27 H31 N O6 |
| Smiles: | CCCCCCc1cc2C3CCCCC=3C(=O)Oc2cc1OCc1cc(ccc1OC)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 7.5566 |
| logD: | 7.5566 |
| logSw: | -5.6786 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 69.407 |
| InChI Key: | CUZHDBQHNSRRHH-UHFFFAOYSA-N |