3-benzyl-7-[(3-chlorophenyl)methoxy]-4-methyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
3-benzyl-7-[(3-chlorophenyl)methoxy]-4-methyl-2H-1-benzopyran-2-one
3-benzyl-7-[(3-chlorophenyl)methoxy]-4-methyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | Y040-7738 |
| Compound Name: | 3-benzyl-7-[(3-chlorophenyl)methoxy]-4-methyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 390.87 |
| Molecular Formula: | C24 H19 Cl O3 |
| Smiles: | CC1=C(Cc2ccccc2)C(=O)Oc2cc(ccc12)OCc1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.1347 |
| logD: | 6.1347 |
| logSw: | -6.0422 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.1161 |
| InChI Key: | CDJGODQPSAMPNU-UHFFFAOYSA-N |