6-methyl-7-{[3-(trifluoromethyl)phenyl]methoxy}-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one
Chemical Structure Depiction of
6-methyl-7-{[3-(trifluoromethyl)phenyl]methoxy}-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one
6-methyl-7-{[3-(trifluoromethyl)phenyl]methoxy}-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one
Compound characteristics
| Compound ID: | Y040-7767 |
| Compound Name: | 6-methyl-7-{[3-(trifluoromethyl)phenyl]methoxy}-2,3-dihydrobenzo[b]cyclopenta[d]pyran-4(1H)-one |
| Molecular Weight: | 374.36 |
| Molecular Formula: | C21 H17 F3 O3 |
| Smiles: | Cc1c(ccc2C3CCCC=3C(=O)Oc12)OCc1cccc(c1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 5.1951 |
| logD: | 5.1951 |
| logSw: | -5.2868 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.4451 |
| InChI Key: | HWYHZZUYAVJIGV-UHFFFAOYSA-N |