N-{2-[(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}methionine
Chemical Structure Depiction of
N-{2-[(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}methionine
N-{2-[(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}methionine
Compound characteristics
| Compound ID: | Y040-8313 |
| Compound Name: | N-{2-[(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}methionine |
| Molecular Weight: | 435.54 |
| Molecular Formula: | C22 H29 N O6 S |
| Smiles: | CCCCC1=CC(=O)Oc2c1ccc(c2C)OC(C)C(N[C@@H](CCSC)C(O)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.0299 |
| logD: | -0.5879 |
| logSw: | -3.4376 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.929 |
| InChI Key: | IGEMCFUXXCCYPI-JRZJBTRGSA-N |