6-(4-oxoquinazolin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide
Chemical Structure Depiction of
6-(4-oxoquinazolin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide
6-(4-oxoquinazolin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide
Compound characteristics
| Compound ID: | Y040-8668 |
| Compound Name: | 6-(4-oxoquinazolin-3(4H)-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide |
| Molecular Weight: | 403.4 |
| Molecular Formula: | C21 H20 F3 N3 O2 |
| Smiles: | C(CCC(Nc1cccc(c1)C(F)(F)F)=O)CCN1C=Nc2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 3.4174 |
| logD: | 3.4166 |
| logSw: | -3.9052 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.467 |
| InChI Key: | DRWQDCRFPGDCOZ-UHFFFAOYSA-N |