N-{3-[(1,3-benzothiazol-2-yl)amino]-3-oxopropyl}-6-methoxy-1H-indole-2-carboxamide
Chemical Structure Depiction of
N-{3-[(1,3-benzothiazol-2-yl)amino]-3-oxopropyl}-6-methoxy-1H-indole-2-carboxamide
N-{3-[(1,3-benzothiazol-2-yl)amino]-3-oxopropyl}-6-methoxy-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | Y040-8894 |
| Compound Name: | N-{3-[(1,3-benzothiazol-2-yl)amino]-3-oxopropyl}-6-methoxy-1H-indole-2-carboxamide |
| Molecular Weight: | 394.45 |
| Molecular Formula: | C20 H18 N4 O3 S |
| Smiles: | COc1ccc2cc(C(NCCC(Nc3nc4ccccc4s3)=O)=O)[nH]c2c1 |
| Stereo: | ACHIRAL |
| logP: | 3.7098 |
| logD: | 3.7097 |
| logSw: | -4.1404 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 74.297 |
| InChI Key: | CVAIMNGTCGNZHZ-UHFFFAOYSA-N |