N-{4-[(1,3-benzothiazol-2-yl)amino]-4-oxobutyl}-4,5-dimethoxy-1H-indole-2-carboxamide
Chemical Structure Depiction of
N-{4-[(1,3-benzothiazol-2-yl)amino]-4-oxobutyl}-4,5-dimethoxy-1H-indole-2-carboxamide
N-{4-[(1,3-benzothiazol-2-yl)amino]-4-oxobutyl}-4,5-dimethoxy-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | Y040-8964 |
| Compound Name: | N-{4-[(1,3-benzothiazol-2-yl)amino]-4-oxobutyl}-4,5-dimethoxy-1H-indole-2-carboxamide |
| Molecular Weight: | 438.5 |
| Molecular Formula: | C22 H22 N4 O4 S |
| Smiles: | COc1ccc2c(cc(C(NCCCC(Nc3nc4ccccc4s3)=O)=O)[nH]2)c1OC |
| Stereo: | ACHIRAL |
| logP: | 3.2149 |
| logD: | 3.2148 |
| logSw: | -3.4997 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 82.101 |
| InChI Key: | FYSQHXVMKPJXMP-UHFFFAOYSA-N |