1-phenyl-N-[(4-sulfamoylphenyl)methyl]-3-(thiophen-2-yl)-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
1-phenyl-N-[(4-sulfamoylphenyl)methyl]-3-(thiophen-2-yl)-1H-pyrazole-5-carboxamide
1-phenyl-N-[(4-sulfamoylphenyl)methyl]-3-(thiophen-2-yl)-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | Y040-9331 |
| Compound Name: | 1-phenyl-N-[(4-sulfamoylphenyl)methyl]-3-(thiophen-2-yl)-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 438.53 |
| Molecular Formula: | C21 H18 N4 O3 S2 |
| Smiles: | C(c1ccc(cc1)S(N)(=O)=O)NC(c1cc(c2cccs2)nn1c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9213 |
| logD: | 2.9206 |
| logSw: | -3.5386 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 89.096 |
| InChI Key: | NSMIVZOFSICVQL-UHFFFAOYSA-N |