4-(naphthalen-1-yl)pyrimidine-2(1H)-thione
Chemical Structure Depiction of
4-(naphthalen-1-yl)pyrimidine-2(1H)-thione
4-(naphthalen-1-yl)pyrimidine-2(1H)-thione
Compound characteristics
| Compound ID: | Y040-9536 |
| Compound Name: | 4-(naphthalen-1-yl)pyrimidine-2(1H)-thione |
| Molecular Weight: | 238.31 |
| Molecular Formula: | C14 H10 N2 S |
| Smiles: | C1=CNC(N=C1c1cccc2ccccc12)=S |
| Stereo: | ACHIRAL |
| logP: | 2.6483 |
| logD: | 1.9603 |
| logSw: | -3.3177 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 19.5659 |
| InChI Key: | OUWKLNHPFBIOLC-UHFFFAOYSA-N |