methyl {1-[(5-bromo-1H-indol-1-yl)acetyl]piperidin-4-yl}acetate
Chemical Structure Depiction of
methyl {1-[(5-bromo-1H-indol-1-yl)acetyl]piperidin-4-yl}acetate
methyl {1-[(5-bromo-1H-indol-1-yl)acetyl]piperidin-4-yl}acetate
Compound characteristics
| Compound ID: | Y041-0336 |
| Compound Name: | methyl {1-[(5-bromo-1H-indol-1-yl)acetyl]piperidin-4-yl}acetate |
| Molecular Weight: | 393.28 |
| Molecular Formula: | C18 H21 Br N2 O3 |
| Smiles: | COC(CC1CCN(CC1)C(Cn1ccc2cc(ccc12)[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1629 |
| logD: | 3.1629 |
| logSw: | -3.2013 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.049 |
| InChI Key: | OCFGZXPRMVDQOV-UHFFFAOYSA-N |