N-[(4-chlorophenyl)methyl]-2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]acetamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]acetamide
N-[(4-chlorophenyl)methyl]-2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]acetamide
Compound characteristics
| Compound ID: | Y041-0555 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-2-[3-(4-chlorophenyl)-6-oxopyridazin-1(6H)-yl]acetamide |
| Molecular Weight: | 388.25 |
| Molecular Formula: | C19 H15 Cl2 N3 O2 |
| Smiles: | C(c1ccc(cc1)[Cl])NC(CN1C(C=CC(c2ccc(cc2)[Cl])=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7801 |
| logD: | 3.7801 |
| logSw: | -4.514 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.019 |
| InChI Key: | LVCNUROOHHYFPA-UHFFFAOYSA-N |