5-(1H-pyrrol-1-yl)-1-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxylic acid
Chemical Structure Depiction of
5-(1H-pyrrol-1-yl)-1-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxylic acid
5-(1H-pyrrol-1-yl)-1-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxylic acid
Compound characteristics
| Compound ID: | Y041-0715 |
| Compound Name: | 5-(1H-pyrrol-1-yl)-1-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxylic acid |
| Molecular Weight: | 337.26 |
| Molecular Formula: | C15 H10 F3 N3 O3 |
| Smiles: | c1ccn(c1)c1c(cnn1c1ccc(cc1)OC(F)(F)F)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4582 |
| logD: | -0.6245 |
| logSw: | -4.356 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.44 |
| InChI Key: | PXIIFUNIAOAVPA-UHFFFAOYSA-N |