N-[(6-chloro-7-methoxy-4-methyl-2-oxo-2H-1-benzopyran-3-yl)acetyl]-D-methionine
Chemical Structure Depiction of
N-[(6-chloro-7-methoxy-4-methyl-2-oxo-2H-1-benzopyran-3-yl)acetyl]-D-methionine
N-[(6-chloro-7-methoxy-4-methyl-2-oxo-2H-1-benzopyran-3-yl)acetyl]-D-methionine
Compound characteristics
| Compound ID: | Y041-2354 |
| Compound Name: | N-[(6-chloro-7-methoxy-4-methyl-2-oxo-2H-1-benzopyran-3-yl)acetyl]-D-methionine |
| Molecular Weight: | 413.88 |
| Molecular Formula: | C18 H20 Cl N O6 S |
| Smiles: | CC1=C(CC(N[C@H](CCSC)C(O)=O)=O)C(=O)Oc2cc(c(cc12)[Cl])OC |
| Stereo: | ABSOLUTE |
| logP: | 2.0076 |
| logD: | -1.6103 |
| logSw: | -2.8439 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.3 |
| InChI Key: | UNKAYAGYSDCWEN-ZDUSSCGKSA-N |