8-[(dimethylamino)methyl]-3-(2-ethoxyphenoxy)-7-hydroxy-2-methyl-4H-1-benzopyran-4-one
Chemical Structure Depiction of
8-[(dimethylamino)methyl]-3-(2-ethoxyphenoxy)-7-hydroxy-2-methyl-4H-1-benzopyran-4-one
8-[(dimethylamino)methyl]-3-(2-ethoxyphenoxy)-7-hydroxy-2-methyl-4H-1-benzopyran-4-one
Compound characteristics
| Compound ID: | Y041-2738 |
| Compound Name: | 8-[(dimethylamino)methyl]-3-(2-ethoxyphenoxy)-7-hydroxy-2-methyl-4H-1-benzopyran-4-one |
| Molecular Weight: | 369.42 |
| Molecular Formula: | C21 H23 N O5 |
| Smiles: | CCOc1ccccc1OC1=C(C)Oc2c(ccc(c2CN(C)C)O)C1=O |
| Stereo: | ACHIRAL |
| logP: | 3.4058 |
| logD: | 2.6292 |
| logSw: | -3.5732 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.079 |
| InChI Key: | RYXLDWHPRNOSOH-UHFFFAOYSA-N |