1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[2-(1H-pyrrol-1-yl)-1,3-thiazol-4-yl]ethan-1-one
Chemical Structure Depiction of
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[2-(1H-pyrrol-1-yl)-1,3-thiazol-4-yl]ethan-1-one
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[2-(1H-pyrrol-1-yl)-1,3-thiazol-4-yl]ethan-1-one
Compound characteristics
| Compound ID: | Y041-3494 |
| Compound Name: | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[2-(1H-pyrrol-1-yl)-1,3-thiazol-4-yl]ethan-1-one |
| Molecular Weight: | 386.9 |
| Molecular Formula: | C19 H19 Cl N4 O S |
| Smiles: | C(C(N1CCN(CC1)c1ccc(cc1)[Cl])=O)c1csc(n1)n1cccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.3421 |
| logD: | 4.3421 |
| logSw: | -4.7023 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.921 |
| InChI Key: | CIYCFNHXYKFUKS-UHFFFAOYSA-N |