7-(3-{[(3,4-dimethoxyphenyl)methyl]amino}-2-hydroxypropoxy)-3,4-dimethyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
7-(3-{[(3,4-dimethoxyphenyl)methyl]amino}-2-hydroxypropoxy)-3,4-dimethyl-2H-1-benzopyran-2-one
7-(3-{[(3,4-dimethoxyphenyl)methyl]amino}-2-hydroxypropoxy)-3,4-dimethyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | Y041-4511 |
| Compound Name: | 7-(3-{[(3,4-dimethoxyphenyl)methyl]amino}-2-hydroxypropoxy)-3,4-dimethyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 413.47 |
| Molecular Formula: | C23 H27 N O6 |
| Smiles: | CC1=C(C)c2ccc(cc2OC1=O)OCC(CNCc1ccc(c(c1)OC)OC)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6868 |
| logD: | 0.4411 |
| logSw: | -3.095 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.305 |
| InChI Key: | JGYPETXGAOMZJK-KRWDZBQOSA-N |