5,10-dimethyl-2-[2-(trifluoromethoxy)phenyl]-2,3-dihydro-4H,8H-benzo[1,2-b:3,4-b']dipyran-4,8-dione
Chemical Structure Depiction of
5,10-dimethyl-2-[2-(trifluoromethoxy)phenyl]-2,3-dihydro-4H,8H-benzo[1,2-b:3,4-b']dipyran-4,8-dione
5,10-dimethyl-2-[2-(trifluoromethoxy)phenyl]-2,3-dihydro-4H,8H-benzo[1,2-b:3,4-b']dipyran-4,8-dione
Compound characteristics
| Compound ID: | Y041-4755 |
| Compound Name: | 5,10-dimethyl-2-[2-(trifluoromethoxy)phenyl]-2,3-dihydro-4H,8H-benzo[1,2-b:3,4-b']dipyran-4,8-dione |
| Molecular Weight: | 404.34 |
| Molecular Formula: | C21 H15 F3 O5 |
| Smiles: | CC1=CC(=O)Oc2cc(C)c3C(CC(c4ccccc4OC(F)(F)F)Oc3c12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9576 |
| logD: | 4.9576 |
| logSw: | -4.8986 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 46.317 |
| InChI Key: | QOSAJPNBFDVQAF-HNNXBMFYSA-N |